About lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one
lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one (PubChem CID 174476920) has the molecular formula C16H18LiOP
and a molecular weight of 264.23 g/mol. Its IUPAC name is lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one.
Molecular Properties
| Compound Name | lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one |
| PubChem CID | 174476920 |
| Molecular Formula | C16H18LiOP |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one |
| SMILES | Cc1cccc(-c2ccccc2)c1C(=O)C(C)P.[H-].[Li+] |
| InChI | InChI=1S/C16H17OP.Li.H/c1-11-7-6-10-14(13-8-4-3-5-9-13)15(11)16(17)12(2)18;;/h3-10,12H,18H2,1-2H3;;/q;+1;-1 |
| InChIKey | QWKSQFLFRXOSLJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one?
The IUPAC name of lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one (CID 174476920) is lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one.
What is the SMILES notation for lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one?
The canonical SMILES for lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one is Cc1cccc(-c2ccccc2)c1C(=O)C(C)P.[H-].[Li+].
What is the InChIKey of lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one?
The InChIKey is QWKSQFLFRXOSLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17OP.Li.H/c1-11-7-6-10-14(13-8-4-3-5-9-13)15(11)16(17)12(2)18;;/h3-10,12H,18H2,1-2H3;;/q;+1;-1.
What are the key properties of lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one?
lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one has a molecular weight of 264.23 g/mol, XLogP of 1.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;1-(2-methyl-6-phenylphenyl)-2-phosphanylpropan-1-one is sourced from PubChem (CID 174476920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).