C15H20LiOP — CID 141022858
lithium cyclopentyl-(2,3,6-trimethylbenzoyl)phosphanide (PubChem CID 141022858) has the molecular formula C15H20LiOP and a molecular weight of 254.24 g/mol. Its IUPAC name is lithium cyclopentyl-(2,3,6-trimethylbenzoyl)phosphanide.
| Compound Name | lithium cyclopentyl-(2,3,6-trimethylbenzoyl)phosphanide |
|---|---|
| PubChem CID | 141022858 |
| Molecular Formula | C15H20LiOP |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | lithium cyclopentyl-(2,3,6-trimethylbenzoyl)phosphanide |
| SMILES | Cc1ccc(C)c(C(=O)[P-]C2CCCC2)c1C.[Li+] |
| InChI | InChI=1S/C15H20OP.Li/c1-10-8-9-11(2)14(12(10)3)15(16)17-13-6-4-5-7-13;/h8-9,13H,4-7H2,1-3H3;/q-1;+1 |
| InChIKey | HTFYKPPSIGIDBI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|