C14H10Cl2O2P- — CID 141016758
(3,6-dichloro-2-methoxyphenyl)-phenylphosphanylidenemethanolate (PubChem CID 141016758) has the molecular formula C14H10Cl2O2P- and a molecular weight of 312.11 g/mol. Its IUPAC name is (3,6-dichloro-2-methoxyphenyl)-phenylphosphanylidenemethanolate.
| Compound Name | (3,6-dichloro-2-methoxyphenyl)-phenylphosphanylidenemethanolate |
|---|---|
| PubChem CID | 141016758 |
| Molecular Formula | C14H10Cl2O2P- |
| Molecular Weight | 312.11 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | (3,6-dichloro-2-methoxyphenyl)-phenylphosphanylidenemethanolate |
| SMILES | COc1c(Cl)ccc(Cl)c1/C([O-])=P/c1ccccc1 |
| InChI | InChI=1S/C14H11Cl2O2P/c1-18-13-11(16)8-7-10(15)12(13)14(17)19-9-5-3-2-4-6-9/h2-8,17H,1H3/p-1 |
| InChIKey | NBKVMLKXKOSXEB-UHFFFAOYSA-M |
| XLogP | 3.11 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.11 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|