C19H21Cl2N3O3 — CID 108574925
3,6-dichloro-N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]-2-methoxybenzamide (PubChem CID 108574925) has the molecular formula C19H21Cl2N3O3 and a molecular weight of 410.30 g/mol. Its IUPAC name is 3,6-dichloro-N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]-2-methoxybenzamide.
| Compound Name | 3,6-dichloro-N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 108574925 |
| Molecular Formula | C19H21Cl2N3O3 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 3,6-dichloro-N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]-2-methoxybenzamide |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)NCCNC(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H21Cl2N3O3/c1-24(2)13-6-4-12(5-7-13)18(25)22-10-11-23-19(26)16-14(20)8-9-15(21)17(16)27-3/h4-9H,10-11H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | JJTDZXQCVVSIGC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|