C17H25BrO3P- — CID 141022955
(3-bromo-2,6-dimethoxyphenyl)-(2,4,4-trimethylpentylphosphanylidene)methanolate (PubChem CID 141022955) has the molecular formula C17H25BrO3P- and a molecular weight of 388.26 g/mol. Its IUPAC name is (3-bromo-2,6-dimethoxyphenyl)-(2,4,4-trimethylpentylphosphanylidene)methanolate.
| Compound Name | (3-bromo-2,6-dimethoxyphenyl)-(2,4,4-trimethylpentylphosphanylidene)methanolate |
|---|---|
| PubChem CID | 141022955 |
| Molecular Formula | C17H25BrO3P- |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (3-bromo-2,6-dimethoxyphenyl)-(2,4,4-trimethylpentylphosphanylidene)methanolate |
| SMILES | COc1ccc(Br)c(OC)c1/C([O-])=P/CC(C)CC(C)(C)C |
| InChI | InChI=1S/C17H26BrO3P/c1-11(9-17(2,3)4)10-22-16(19)14-13(20-5)8-7-12(18)15(14)21-6/h7-8,11,19H,9-10H2,1-6H3/p-1 |
| InChIKey | OWFHDSJDHWRWHT-UHFFFAOYSA-M |
| XLogP | 4.32 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|