C34H46O6 — CID 135239787
[10-(2-ethylhexoxycarbonyloxy)-2,6-dimethylanthracen-9-yl] 2-ethylhexyl carbonate (PubChem CID 135239787) has the molecular formula C34H46O6 and a molecular weight of 550.74 g/mol. Its IUPAC name is [10-(2-ethylhexoxycarbonyloxy)-2,6-dimethylanthracen-9-yl] 2-ethylhexyl carbonate.
| Compound Name | [10-(2-ethylhexoxycarbonyloxy)-2,6-dimethylanthracen-9-yl] 2-ethylhexyl carbonate |
|---|---|
| PubChem CID | 135239787 |
| Molecular Formula | C34H46O6 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | [10-(2-ethylhexoxycarbonyloxy)-2,6-dimethylanthracen-9-yl] 2-ethylhexyl carbonate |
| SMILES | CCCCC(CC)COC(=O)Oc1c2ccc(C)cc2c(OC(=O)OCC(CC)CCCC)c2ccc(C)cc12 |
| InChI | InChI=1S/C34H46O6/c1-7-11-13-25(9-3)21-37-33(35)39-31-27-17-15-24(6)20-30(27)32(28-18-16-23(5)19-29(28)31)40-34(36)38-22-26(10-4)14-12-8-2/h15-20,25-26H,7-14,21-22H2,1-6H3 |
| InChIKey | AVHVWTUXFCFGPM-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|