C33H46O6 — CID 153323271
[10-(2-ethylhexoxycarbonyloxy)-2-methyl-1,4-dihydroanthracen-9-yl] 2-ethylhexyl carbonate (PubChem CID 153323271) has the molecular formula C33H46O6 and a molecular weight of 538.73 g/mol. Its IUPAC name is [10-(2-ethylhexoxycarbonyloxy)-2-methyl-1,4-dihydroanthracen-9-yl] 2-ethylhexyl carbonate.
| Compound Name | [10-(2-ethylhexoxycarbonyloxy)-2-methyl-1,4-dihydroanthracen-9-yl] 2-ethylhexyl carbonate |
|---|---|
| PubChem CID | 153323271 |
| Molecular Formula | C33H46O6 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | [10-(2-ethylhexoxycarbonyloxy)-2-methyl-1,4-dihydroanthracen-9-yl] 2-ethylhexyl carbonate |
| SMILES | CCCCC(CC)COC(=O)Oc1c2c(c(OC(=O)OCC(CC)CCCC)c3ccccc13)CC(C)=CC2 |
| InChI | InChI=1S/C33H46O6/c1-6-10-14-24(8-3)21-36-32(34)38-30-26-16-12-13-17-27(26)31(29-20-23(5)18-19-28(29)30)39-33(35)37-22-25(9-4)15-11-7-2/h12-13,16-18,24-25H,6-11,14-15,19-22H2,1-5H3 |
| InChIKey | YQZTXZGGWDCREK-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|