C27H38O7 — CID 19886888
[2-methoxy-4-(2-methylhexoxycarbonyloxy)naphthalen-1-yl] 2-methylhexyl carbonate (PubChem CID 19886888) has the molecular formula C27H38O7 and a molecular weight of 474.59 g/mol. Its IUPAC name is [2-methoxy-4-(2-methylhexoxycarbonyloxy)naphthalen-1-yl] 2-methylhexyl carbonate.
| Compound Name | [2-methoxy-4-(2-methylhexoxycarbonyloxy)naphthalen-1-yl] 2-methylhexyl carbonate |
|---|---|
| PubChem CID | 19886888 |
| Molecular Formula | C27H38O7 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | [2-methoxy-4-(2-methylhexoxycarbonyloxy)naphthalen-1-yl] 2-methylhexyl carbonate |
| SMILES | CCCCC(C)COC(=O)Oc1cc(OC)c(OC(=O)OCC(C)CCCC)c2ccccc12 |
| InChI | InChI=1S/C27H38O7/c1-6-8-12-19(3)17-31-26(28)33-23-16-24(30-5)25(22-15-11-10-14-21(22)23)34-27(29)32-18-20(4)13-9-7-2/h10-11,14-16,19-20H,6-9,12-13,17-18H2,1-5H3 |
| InChIKey | RDEVOMADXMFXPT-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|