C20H27NO3 — CID 14100498
(2-butyl-4-methoxynaphthalen-1-yl) (2S)-2-amino-3-methylbutanoate (PubChem CID 14100498) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (2-butyl-4-methoxynaphthalen-1-yl) (2S)-2-amino-3-methylbutanoate.
| Compound Name | (2-butyl-4-methoxynaphthalen-1-yl) (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 14100498 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (2-butyl-4-methoxynaphthalen-1-yl) (2S)-2-amino-3-methylbutanoate |
| SMILES | CCCCc1cc(OC)c2ccccc2c1OC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C20H27NO3/c1-5-6-9-14-12-17(23-4)15-10-7-8-11-16(15)19(14)24-20(22)18(21)13(2)3/h7-8,10-13,18H,5-6,9,21H2,1-4H3/t18-/m0/s1 |
| InChIKey | VTQCIHOIPKIWGK-SFHVURJKSA-N |
| XLogP | 4.08 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|