About O-(2-butylphenyl) carbamothioate;carbamothioic S-acid
O-(2-butylphenyl) carbamothioate;carbamothioic S-acid (PubChem CID 87663702) has the molecular formula C12H18N2O2S2
and a molecular weight of 286.42 g/mol. Its IUPAC name is O-(2-butylphenyl) carbamothioate;carbamothioic S-acid.
Molecular Properties
| Compound Name | O-(2-butylphenyl) carbamothioate;carbamothioic S-acid |
| PubChem CID | 87663702 |
| Molecular Formula | C12H18N2O2S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | O-(2-butylphenyl) carbamothioate;carbamothioic S-acid |
| SMILES | CCCCc1ccccc1OC(N)=S.NC(=O)S |
| InChI | InChI=1S/C11H15NOS.CH3NOS/c1-2-3-6-9-7-4-5-8-10(9)13-11(12)14;2-1(3)4/h4-5,7-8H,2-3,6H2,1H3,(H2,12,14);(H3,2,3,4) |
| InChIKey | RQWRMNRMYHFEFK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze O-(2-butylphenyl) carbamothioate;carbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-butylphenyl) carbamothioate;carbamothioic S-acid?
The IUPAC name of O-(2-butylphenyl) carbamothioate;carbamothioic S-acid (CID 87663702) is O-(2-butylphenyl) carbamothioate;carbamothioic S-acid.
What is the SMILES notation for O-(2-butylphenyl) carbamothioate;carbamothioic S-acid?
The canonical SMILES for O-(2-butylphenyl) carbamothioate;carbamothioic S-acid is CCCCc1ccccc1OC(N)=S.NC(=O)S.
What is the InChIKey of O-(2-butylphenyl) carbamothioate;carbamothioic S-acid?
The InChIKey is RQWRMNRMYHFEFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NOS.CH3NOS/c1-2-3-6-9-7-4-5-8-10(9)13-11(12)14;2-1(3)4/h4-5,7-8H,2-3,6H2,1H3,(H2,12,14);(H3,2,3,4).
What are the key properties of O-(2-butylphenyl) carbamothioate;carbamothioic S-acid?
O-(2-butylphenyl) carbamothioate;carbamothioic S-acid has a molecular weight of 286.42 g/mol, XLogP of 2.65, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-butylphenyl) carbamothioate;carbamothioic S-acid is sourced from PubChem (CID 87663702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).