C20H21NO5 — CID 56642560
(6-methoxy-2-oxobenzo[h]chromen-4-yl)methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 56642560) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is (6-methoxy-2-oxobenzo[h]chromen-4-yl)methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | (6-methoxy-2-oxobenzo[h]chromen-4-yl)methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 56642560 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (6-methoxy-2-oxobenzo[h]chromen-4-yl)methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | COc1cc2c(COC(=O)[C@@H](N)C(C)C)cc(=O)oc2c2ccccc12 |
| InChI | InChI=1S/C20H21NO5/c1-11(2)18(21)20(23)25-10-12-8-17(22)26-19-14-7-5-4-6-13(14)16(24-3)9-15(12)19/h4-9,11,18H,10,21H2,1-3H3/t18-/m0/s1 |
| InChIKey | RTRVYEAINWLWKD-SFHVURJKSA-N |
| XLogP | 2.98 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|