C25H27NO8 — CID 132573092
(6-methoxy-2-oxobenzo[h]chromen-4-yl)methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate (PubChem CID 132573092) has the molecular formula C25H27NO8 and a molecular weight of 469.49 g/mol. Its IUPAC name is (6-methoxy-2-oxobenzo[h]chromen-4-yl)methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate.
| Compound Name | (6-methoxy-2-oxobenzo[h]chromen-4-yl)methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate |
|---|---|
| PubChem CID | 132573092 |
| Molecular Formula | C25H27NO8 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (6-methoxy-2-oxobenzo[h]chromen-4-yl)methyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate |
| SMILES | COc1cc2c(COC(=O)CCC(=O)CNC(=O)OC(C)(C)C)cc(=O)oc2c2ccccc12 |
| InChI | InChI=1S/C25H27NO8/c1-25(2,3)34-24(30)26-13-16(27)9-10-21(28)32-14-15-11-22(29)33-23-18-8-6-5-7-17(18)20(31-4)12-19(15)23/h5-8,11-12H,9-10,13-14H2,1-4H3,(H,26,30) |
| InChIKey | ZWTBNMDATIBWKD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|