C24H29Br3O2 — CID 10507616
[4-[5-bromo-2-(1,2-dibromoethyl)phenyl]-2,6-ditert-butylphenyl] acetate (PubChem CID 10507616) has the molecular formula C24H29Br3O2 and a molecular weight of 589.21 g/mol. Its IUPAC name is [4-[5-bromo-2-(1,2-dibromoethyl)phenyl]-2,6-ditert-butylphenyl] acetate.
| Compound Name | [4-[5-bromo-2-(1,2-dibromoethyl)phenyl]-2,6-ditert-butylphenyl] acetate |
|---|---|
| PubChem CID | 10507616 |
| Molecular Formula | C24H29Br3O2 |
| Molecular Weight | 589.21 g/mol |
| Exact Mass | 585.97 |
| IUPAC Name | [4-[5-bromo-2-(1,2-dibromoethyl)phenyl]-2,6-ditert-butylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)cc(-c2cc(Br)ccc2C(Br)CBr)cc1C(C)(C)C |
| InChI | InChI=1S/C24H29Br3O2/c1-14(28)29-22-19(23(2,3)4)10-15(11-20(22)24(5,6)7)18-12-16(26)8-9-17(18)21(27)13-25/h8-12,21H,13H2,1-7H3 |
| InChIKey | HSCGLKDMCDYDAK-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.21 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|