C9H7NO3S — CID 174599806
(5-thiophen-3-yl-1,2-oxazol-3-yl) acetate (PubChem CID 174599806) has the molecular formula C9H7NO3S and a molecular weight of 209.23 g/mol. Its IUPAC name is (5-thiophen-3-yl-1,2-oxazol-3-yl) acetate.
| Compound Name | (5-thiophen-3-yl-1,2-oxazol-3-yl) acetate |
|---|---|
| PubChem CID | 174599806 |
| Molecular Formula | C9H7NO3S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | (5-thiophen-3-yl-1,2-oxazol-3-yl) acetate |
| SMILES | CC(=O)Oc1cc(-c2ccsc2)on1 |
| InChI | InChI=1S/C9H7NO3S/c1-6(11)12-9-4-8(13-10-9)7-2-3-14-5-7/h2-5H,1H3 |
| InChIKey | PAKQDQTWTRHRDA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |