C14H17N3O3 — CID 67106921
[5-(4-aminophenyl)-1,2-oxazol-3-yl] N,N-diethylcarbamate (PubChem CID 67106921) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is [5-(4-aminophenyl)-1,2-oxazol-3-yl] N,N-diethylcarbamate.
| Compound Name | [5-(4-aminophenyl)-1,2-oxazol-3-yl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 67106921 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | [5-(4-aminophenyl)-1,2-oxazol-3-yl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1cc(-c2ccc(N)cc2)on1 |
| InChI | InChI=1S/C14H17N3O3/c1-3-17(4-2)14(18)19-13-9-12(20-16-13)10-5-7-11(15)8-6-10/h5-9H,3-4,15H2,1-2H3 |
| InChIKey | VGXOKHOTUKPSAI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|