C22H17F3N2O4 — CID 20636750
[4-methyl-2-[[4-[4-(trifluoromethyl)phenoxy]phenyl]carbamoyl]-3-pyridinyl] acetate (PubChem CID 20636750) has the molecular formula C22H17F3N2O4 and a molecular weight of 430.38 g/mol. Its IUPAC name is [4-methyl-2-[[4-[4-(trifluoromethyl)phenoxy]phenyl]carbamoyl]-3-pyridinyl] acetate.
| Compound Name | [4-methyl-2-[[4-[4-(trifluoromethyl)phenoxy]phenyl]carbamoyl]-3-pyridinyl] acetate |
|---|---|
| PubChem CID | 20636750 |
| Molecular Formula | C22H17F3N2O4 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | [4-methyl-2-[[4-[4-(trifluoromethyl)phenoxy]phenyl]carbamoyl]-3-pyridinyl] acetate |
| SMILES | CC(=O)Oc1c(C)ccnc1C(=O)Nc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H17F3N2O4/c1-13-11-12-26-19(20(13)30-14(2)28)21(29)27-16-5-9-18(10-6-16)31-17-7-3-15(4-8-17)22(23,24)25/h3-12H,1-2H3,(H,27,29) |
| InChIKey | YMNCWXRLSYHXTD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |