C12H10F3N3O — CID 110683987
5-methyl-N-[4-(trifluoromethyl)phenyl]-1H-imidazole-4-carboxamide (PubChem CID 110683987) has the molecular formula C12H10F3N3O and a molecular weight of 269.23 g/mol. Its IUPAC name is 5-methyl-N-[4-(trifluoromethyl)phenyl]-1H-imidazole-4-carboxamide.
| Compound Name | 5-methyl-N-[4-(trifluoromethyl)phenyl]-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 110683987 |
| Molecular Formula | C12H10F3N3O |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 5-methyl-N-[4-(trifluoromethyl)phenyl]-1H-imidazole-4-carboxamide |
| SMILES | Cc1[nH]cnc1C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F3N3O/c1-7-10(17-6-16-7)11(19)18-9-4-2-8(3-5-9)12(13,14)15/h2-6H,1H3,(H,16,17)(H,18,19) |
| InChIKey | MGZNOTDZXGIQQF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |