C23H17F3N2O5 — CID 20636730
[3-(trifluoromethyl)phenyl] 4-[(3-acetyloxy-4-methylpyridine-2-carbonyl)amino]benzoate (PubChem CID 20636730) has the molecular formula C23H17F3N2O5 and a molecular weight of 458.39 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] 4-[(3-acetyloxy-4-methylpyridine-2-carbonyl)amino]benzoate.
| Compound Name | [3-(trifluoromethyl)phenyl] 4-[(3-acetyloxy-4-methylpyridine-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 20636730 |
| Molecular Formula | C23H17F3N2O5 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] 4-[(3-acetyloxy-4-methylpyridine-2-carbonyl)amino]benzoate |
| SMILES | CC(=O)Oc1c(C)ccnc1C(=O)Nc1ccc(C(=O)Oc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H17F3N2O5/c1-13-10-11-27-19(20(13)32-14(2)29)21(30)28-17-8-6-15(7-9-17)22(31)33-18-5-3-4-16(12-18)23(24,25)26/h3-12H,1-2H3,(H,28,30) |
| InChIKey | XRVMKKVQLJYFMG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|