C30H47NO5Si — CID 91211041
N-[[4-[(3,5-ditert-butyl-4-hydroxyphenoxy)methyl-dimethylsilyl]phenyl]methyl]-2-(2-methoxyethoxy)propanamide (PubChem CID 91211041) has the molecular formula C30H47NO5Si and a molecular weight of 529.79 g/mol. Its IUPAC name is N-[[4-[(3,5-ditert-butyl-4-hydroxyphenoxy)methyl-dimethylsilyl]phenyl]methyl]-2-(2-methoxyethoxy)propanamide.
| Compound Name | N-[[4-[(3,5-ditert-butyl-4-hydroxyphenoxy)methyl-dimethylsilyl]phenyl]methyl]-2-(2-methoxyethoxy)propanamide |
|---|---|
| PubChem CID | 91211041 |
| Molecular Formula | C30H47NO5Si |
| Molecular Weight | 529.79 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | N-[[4-[(3,5-ditert-butyl-4-hydroxyphenoxy)methyl-dimethylsilyl]phenyl]methyl]-2-(2-methoxyethoxy)propanamide |
| SMILES | COCCOC(C)C(=O)NCc1ccc([Si](C)(C)COc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C30H47NO5Si/c1-21(35-16-15-34-8)28(33)31-19-22-11-13-24(14-12-22)37(9,10)20-36-23-17-25(29(2,3)4)27(32)26(18-23)30(5,6)7/h11-14,17-18,21,32H,15-16,19-20H2,1-10H3,(H,31,33) |
| InChIKey | BELVYNPDHWRXHM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.79 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|