C42H73NO8Si — CID 161068095
3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(3-trimethoxysilylpropyl)propanamide;methane;methyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 161068095) has the molecular formula C42H73NO8Si and a molecular weight of 748.13 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(3-trimethoxysilylpropyl)propanamide;methane;methyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(3-trimethoxysilylpropyl)propanamide;methane;methyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 161068095 |
| Molecular Formula | C42H73NO8Si |
| Molecular Weight | 748.13 g/mol |
| Exact Mass | 747.51 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(3-trimethoxysilylpropyl)propanamide;methane;methyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | C.COC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.CO[Si](CCCNC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)(OC)OC |
| InChI | InChI=1S/C23H41NO5Si.C18H28O3.CH4/c1-22(2,3)18-15-17(16-19(21(18)26)23(4,5)6)11-12-20(25)24-13-10-14-30(27-7,28-8)29-9;1-17(2,3)13-10-12(8-9-15(19)21-7)11-14(16(13)20)18(4,5)6;/h15-16,26H,10-14H2,1-9H3,(H,24,25);10-11,20H,8-9H2,1-7H3;1H4 |
| InChIKey | UEHLWCDXJOEZOY-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.13 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|