C36H46N2O7 — CID 100921176
(3,5-ditert-butyl-4-hydroxyphenyl)methyl N-[6-[(4-benzoyl-3-hydroxyphenoxy)carbonylamino]hexyl]carbamate (PubChem CID 100921176) has the molecular formula C36H46N2O7 and a molecular weight of 618.77 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)methyl N-[6-[(4-benzoyl-3-hydroxyphenoxy)carbonylamino]hexyl]carbamate.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl N-[6-[(4-benzoyl-3-hydroxyphenoxy)carbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 100921176 |
| Molecular Formula | C36H46N2O7 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl N-[6-[(4-benzoyl-3-hydroxyphenoxy)carbonylamino]hexyl]carbamate |
| SMILES | CC(C)(C)c1cc(COC(=O)NCCCCCCNC(=O)Oc2ccc(C(=O)c3ccccc3)c(O)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C36H46N2O7/c1-35(2,3)28-20-24(21-29(32(28)41)36(4,5)6)23-44-33(42)37-18-12-7-8-13-19-38-34(43)45-26-16-17-27(30(39)22-26)31(40)25-14-10-9-11-15-25/h9-11,14-17,20-22,39,41H,7-8,12-13,18-19,23H2,1-6H3,(H,37,42)(H,38,43) |
| InChIKey | KKVXZUXVBUDTEV-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|