C12H16O4 — CID 117321860
2-(5-tert-butyl-2,3-dihydroxyphenyl)acetic acid (PubChem CID 117321860) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(5-tert-butyl-2,3-dihydroxyphenyl)acetic acid.
| Compound Name | 2-(5-tert-butyl-2,3-dihydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 117321860 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-(5-tert-butyl-2,3-dihydroxyphenyl)acetic acid |
| SMILES | CC(C)(C)c1cc(O)c(O)c(CC(=O)O)c1 |
| InChI | InChI=1S/C12H16O4/c1-12(2,3)8-4-7(5-10(14)15)11(16)9(13)6-8/h4,6,13,16H,5H2,1-3H3,(H,14,15) |
| InChIKey | RXWBCHOZWZLRBZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|