C16H22O4 — CID 175490941
2-(5-tert-butyl-2,3-dihydroxyphenyl)ethyl 2-methylprop-2-enoate (PubChem CID 175490941) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-(5-tert-butyl-2,3-dihydroxyphenyl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(5-tert-butyl-2,3-dihydroxyphenyl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175490941 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-(5-tert-butyl-2,3-dihydroxyphenyl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(C(C)(C)C)cc(O)c1O |
| InChI | InChI=1S/C16H22O4/c1-10(2)15(19)20-7-6-11-8-12(16(3,4)5)9-13(17)14(11)18/h8-9,17-18H,1,6-7H2,2-5H3 |
| InChIKey | KAYIPJUNEHZTFQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|