C25H32O5 — CID 150290528
3-[2-(3,5-ditert-butyl-2-hydroxyphenyl)-1-phenylethoxy]-3-oxopropanoic acid (PubChem CID 150290528) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is 3-[2-(3,5-ditert-butyl-2-hydroxyphenyl)-1-phenylethoxy]-3-oxopropanoic acid.
| Compound Name | 3-[2-(3,5-ditert-butyl-2-hydroxyphenyl)-1-phenylethoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 150290528 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 3-[2-(3,5-ditert-butyl-2-hydroxyphenyl)-1-phenylethoxy]-3-oxopropanoic acid |
| SMILES | CC(C)(C)c1cc(CC(OC(=O)CC(=O)O)c2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H32O5/c1-24(2,3)18-12-17(23(29)19(14-18)25(4,5)6)13-20(16-10-8-7-9-11-16)30-22(28)15-21(26)27/h7-12,14,20,29H,13,15H2,1-6H3,(H,26,27) |
| InChIKey | GHMMAYCUHCWURG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|