C20H33NO3 — CID 21199626
3-(3,5-ditert-butyl-2-hydroxyphenyl)-N-(3-hydroxypropyl)propanamide (PubChem CID 21199626) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-2-hydroxyphenyl)-N-(3-hydroxypropyl)propanamide.
| Compound Name | 3-(3,5-ditert-butyl-2-hydroxyphenyl)-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 21199626 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 3-(3,5-ditert-butyl-2-hydroxyphenyl)-N-(3-hydroxypropyl)propanamide |
| SMILES | CC(C)(C)c1cc(CCC(=O)NCCCO)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H33NO3/c1-19(2,3)15-12-14(8-9-17(23)21-10-7-11-22)18(24)16(13-15)20(4,5)6/h12-13,22,24H,7-11H2,1-6H3,(H,21,23) |
| InChIKey | XJGHUXGLOZHYNQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|