C23H39NO3 — CID 21199515
3-(3,5-ditert-butyl-2-hydroxyphenyl)-N-(6-hydroxyhexyl)propanamide (PubChem CID 21199515) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-2-hydroxyphenyl)-N-(6-hydroxyhexyl)propanamide.
| Compound Name | 3-(3,5-ditert-butyl-2-hydroxyphenyl)-N-(6-hydroxyhexyl)propanamide |
|---|---|
| PubChem CID | 21199515 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | 3-(3,5-ditert-butyl-2-hydroxyphenyl)-N-(6-hydroxyhexyl)propanamide |
| SMILES | CC(C)(C)c1cc(CCC(=O)NCCCCCCO)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H39NO3/c1-22(2,3)18-15-17(21(27)19(16-18)23(4,5)6)11-12-20(26)24-13-9-7-8-10-14-25/h15-16,25,27H,7-14H2,1-6H3,(H,24,26) |
| InChIKey | GKBSGAZMOCFZFF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|