C28H38N2O — CID 87435933
2-[[[(3Z,5E)-5-anilinohepta-1,3,5-trien-2-yl]amino]methyl]-4,6-ditert-butylphenol (PubChem CID 87435933) has the molecular formula C28H38N2O and a molecular weight of 418.63 g/mol. Its IUPAC name is 2-[[[(3Z,5E)-5-anilinohepta-1,3,5-trien-2-yl]amino]methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[[[(3Z,5E)-5-anilinohepta-1,3,5-trien-2-yl]amino]methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 87435933 |
| Molecular Formula | C28H38N2O |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.30 |
| IUPAC Name | 2-[[[(3Z,5E)-5-anilinohepta-1,3,5-trien-2-yl]amino]methyl]-4,6-ditert-butylphenol |
| SMILES | C=C(/C=C\C(=C/C)Nc1ccccc1)NCc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H38N2O/c1-9-23(30-24-13-11-10-12-14-24)16-15-20(2)29-19-21-17-22(27(3,4)5)18-25(26(21)31)28(6,7)8/h9-18,29-31H,2,19H2,1,3-8H3/b16-15-,23-9+ |
| InChIKey | LYXXIRNUHILBDA-UXPUQQNKSA-N |
| XLogP | 7.16 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|