C40H58N2O — CID 89345184
2-tert-butyl-6-[[N-(4-methylpentan-2-yl)-4-[4-(2,4,4-trimethylpentyl)anilino]anilino]methyl]-4-prop-1-en-2-ylphenol (PubChem CID 89345184) has the molecular formula C40H58N2O and a molecular weight of 582.92 g/mol. Its IUPAC name is 2-tert-butyl-6-[[N-(4-methylpentan-2-yl)-4-[4-(2,4,4-trimethylpentyl)anilino]anilino]methyl]-4-prop-1-en-2-ylphenol.
| Compound Name | 2-tert-butyl-6-[[N-(4-methylpentan-2-yl)-4-[4-(2,4,4-trimethylpentyl)anilino]anilino]methyl]-4-prop-1-en-2-ylphenol |
|---|---|
| PubChem CID | 89345184 |
| Molecular Formula | C40H58N2O |
| Molecular Weight | 582.92 g/mol |
| Exact Mass | 582.45 |
| IUPAC Name | 2-tert-butyl-6-[[N-(4-methylpentan-2-yl)-4-[4-(2,4,4-trimethylpentyl)anilino]anilino]methyl]-4-prop-1-en-2-ylphenol |
| SMILES | C=C(C)c1cc(CN(c2ccc(Nc3ccc(CC(C)CC(C)(C)C)cc3)cc2)C(C)CC(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H58N2O/c1-27(2)21-30(6)42(26-33-23-32(28(3)4)24-37(38(33)43)40(10,11)12)36-19-17-35(18-20-36)41-34-15-13-31(14-16-34)22-29(5)25-39(7,8)9/h13-20,23-24,27,29-30,41,43H,3,21-22,25-26H2,1-2,4-12H3 |
| InChIKey | FYVXBVKISCCCNN-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.92 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|