C56H73N7O2 — CID 118094946
4-[3-[[4,6-bis[4-anilino-N-(4-methylpentan-2-yl)anilino]-1,3,5-triazin-2-yl]oxy]propyl]-2,6-ditert-butylphenol (PubChem CID 118094946) has the molecular formula C56H73N7O2 and a molecular weight of 876.25 g/mol. Its IUPAC name is 4-[3-[[4,6-bis[4-anilino-N-(4-methylpentan-2-yl)anilino]-1,3,5-triazin-2-yl]oxy]propyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[3-[[4,6-bis[4-anilino-N-(4-methylpentan-2-yl)anilino]-1,3,5-triazin-2-yl]oxy]propyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 118094946 |
| Molecular Formula | C56H73N7O2 |
| Molecular Weight | 876.25 g/mol |
| Exact Mass | 875.58 |
| IUPAC Name | 4-[3-[[4,6-bis[4-anilino-N-(4-methylpentan-2-yl)anilino]-1,3,5-triazin-2-yl]oxy]propyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)CC(C)N(c1ccc(Nc2ccccc2)cc1)c1nc(OCCCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)nc(N(c2ccc(Nc3ccccc3)cc2)C(C)CC(C)C)n1 |
| InChI | InChI=1S/C56H73N7O2/c1-38(2)34-40(5)62(47-29-25-45(26-30-47)57-43-21-15-13-16-22-43)52-59-53(63(41(6)35-39(3)4)48-31-27-46(28-32-48)58-44-23-17-14-18-24-44)61-54(60-52)65-33-19-20-42-36-49(55(7,8)9)51(64)50(37-42)56(10,11)12/h13-18,21-32,36-41,57-58,64H,19-20,33-35H2,1-12H3 |
| InChIKey | KMVQUYDOBJQBKV-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.25 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|