C39H56N2O — CID 118101921
4-[3-[4-anilino-N-(6,6-dimethylheptan-3-yl)anilino]but-3-enyl]-2,6-ditert-butylphenol (PubChem CID 118101921) has the molecular formula C39H56N2O and a molecular weight of 568.89 g/mol. Its IUPAC name is 4-[3-[4-anilino-N-(6,6-dimethylheptan-3-yl)anilino]but-3-enyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[3-[4-anilino-N-(6,6-dimethylheptan-3-yl)anilino]but-3-enyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 118101921 |
| Molecular Formula | C39H56N2O |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 568.44 |
| IUPAC Name | 4-[3-[4-anilino-N-(6,6-dimethylheptan-3-yl)anilino]but-3-enyl]-2,6-ditert-butylphenol |
| SMILES | C=C(CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)N(c1ccc(Nc2ccccc2)cc1)C(CC)CCC(C)(C)C |
| InChI | InChI=1S/C39H56N2O/c1-12-32(24-25-37(3,4)5)41(33-22-20-31(21-23-33)40-30-16-14-13-15-17-30)28(2)18-19-29-26-34(38(6,7)8)36(42)35(27-29)39(9,10)11/h13-17,20-23,26-27,32,40,42H,2,12,18-19,24-25H2,1,3-11H3 |
| InChIKey | UZKYYOCEXPPTLQ-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |