C29H38N2OS — CID 118563306
2-[4-(4-anilino-N-methylanilino)-2-methylbutyl]sulfanyl-6-tert-butyl-4-methylphenol (PubChem CID 118563306) has the molecular formula C29H38N2OS and a molecular weight of 462.70 g/mol. Its IUPAC name is 2-[4-(4-anilino-N-methylanilino)-2-methylbutyl]sulfanyl-6-tert-butyl-4-methylphenol.
| Compound Name | 2-[4-(4-anilino-N-methylanilino)-2-methylbutyl]sulfanyl-6-tert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 118563306 |
| Molecular Formula | C29H38N2OS |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 2-[4-(4-anilino-N-methylanilino)-2-methylbutyl]sulfanyl-6-tert-butyl-4-methylphenol |
| SMILES | Cc1cc(SCC(C)CCN(C)c2ccc(Nc3ccccc3)cc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H38N2OS/c1-21(20-33-27-19-22(2)18-26(28(27)32)29(3,4)5)16-17-31(6)25-14-12-24(13-15-25)30-23-10-8-7-9-11-23/h7-15,18-19,21,30,32H,16-17,20H2,1-6H3 |
| InChIKey | GAKQIDCIYKNZAL-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|