C28H36N2OS — CID 118567558
2-[4-(4-anilinoanilino)-2-methylbutyl]sulfanyl-6-tert-butyl-4-methylphenol (PubChem CID 118567558) has the molecular formula C28H36N2OS and a molecular weight of 448.68 g/mol. Its IUPAC name is 2-[4-(4-anilinoanilino)-2-methylbutyl]sulfanyl-6-tert-butyl-4-methylphenol.
| Compound Name | 2-[4-(4-anilinoanilino)-2-methylbutyl]sulfanyl-6-tert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 118567558 |
| Molecular Formula | C28H36N2OS |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-[4-(4-anilinoanilino)-2-methylbutyl]sulfanyl-6-tert-butyl-4-methylphenol |
| SMILES | Cc1cc(SCC(C)CCNc2ccc(Nc3ccccc3)cc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H36N2OS/c1-20(19-32-26-18-21(2)17-25(27(26)31)28(3,4)5)15-16-29-22-11-13-24(14-12-22)30-23-9-7-6-8-10-23/h6-14,17-18,20,29-31H,15-16,19H2,1-5H3 |
| InChIKey | IZJVDEZQWBYHLP-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|