C33H38N2OS — CID 118563277
4-[(N-(4-anilinophenyl)anilino)methylsulfanyl]-2,6-ditert-butylphenol (PubChem CID 118563277) has the molecular formula C33H38N2OS and a molecular weight of 510.75 g/mol. Its IUPAC name is 4-[(N-(4-anilinophenyl)anilino)methylsulfanyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[(N-(4-anilinophenyl)anilino)methylsulfanyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 118563277 |
| Molecular Formula | C33H38N2OS |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 4-[(N-(4-anilinophenyl)anilino)methylsulfanyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(SCN(c2ccccc2)c2ccc(Nc3ccccc3)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C33H38N2OS/c1-32(2,3)29-21-28(22-30(31(29)36)33(4,5)6)37-23-35(26-15-11-8-12-16-26)27-19-17-25(18-20-27)34-24-13-9-7-10-14-24/h7-22,34,36H,23H2,1-6H3 |
| InChIKey | SCPCMIQKBXVQQQ-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|