C38H54N2O2S — CID 118567559
S-(3,5-ditert-butyl-4-hydroxyphenyl) 6-(4-anilino-N-hexan-2-ylanilino)hexanethioate (PubChem CID 118567559) has the molecular formula C38H54N2O2S and a molecular weight of 602.93 g/mol. Its IUPAC name is S-(3,5-ditert-butyl-4-hydroxyphenyl) 6-(4-anilino-N-hexan-2-ylanilino)hexanethioate.
| Compound Name | S-(3,5-ditert-butyl-4-hydroxyphenyl) 6-(4-anilino-N-hexan-2-ylanilino)hexanethioate |
|---|---|
| PubChem CID | 118567559 |
| Molecular Formula | C38H54N2O2S |
| Molecular Weight | 602.93 g/mol |
| Exact Mass | 602.39 |
| IUPAC Name | S-(3,5-ditert-butyl-4-hydroxyphenyl) 6-(4-anilino-N-hexan-2-ylanilino)hexanethioate |
| SMILES | CCCCC(C)N(CCCCCC(=O)Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C38H54N2O2S/c1-9-10-17-28(2)40(31-23-21-30(22-24-31)39-29-18-13-11-14-19-29)25-16-12-15-20-35(41)43-32-26-33(37(3,4)5)36(42)34(27-32)38(6,7)8/h11,13-14,18-19,21-24,26-28,39,42H,9-10,12,15-17,20,25H2,1-8H3 |
| InChIKey | OZGKMNLYEUPGBF-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.93 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|