C29H37NO — CID 20764849
2,6-ditert-butyl-4-[1-[4-(4-methylanilino)phenyl]ethyl]phenol (PubChem CID 20764849) has the molecular formula C29H37NO and a molecular weight of 415.62 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[1-[4-(4-methylanilino)phenyl]ethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[1-[4-(4-methylanilino)phenyl]ethyl]phenol |
|---|---|
| PubChem CID | 20764849 |
| Molecular Formula | C29H37NO |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | 2,6-ditert-butyl-4-[1-[4-(4-methylanilino)phenyl]ethyl]phenol |
| SMILES | Cc1ccc(Nc2ccc(C(C)c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)cc2)cc1 |
| InChI | InChI=1S/C29H37NO/c1-19-9-13-23(14-10-19)30-24-15-11-21(12-16-24)20(2)22-17-25(28(3,4)5)27(31)26(18-22)29(6,7)8/h9-18,20,30-31H,1-8H3 |
| InChIKey | SWZYKDUAWXGRIW-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |