C24H36N2O — CID 71485102
2,6-ditert-butyl-4-[[methyl(methylamino)amino]-(4-methylphenyl)methyl]phenol (PubChem CID 71485102) has the molecular formula C24H36N2O and a molecular weight of 368.57 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[methyl(methylamino)amino]-(4-methylphenyl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[methyl(methylamino)amino]-(4-methylphenyl)methyl]phenol |
|---|---|
| PubChem CID | 71485102 |
| Molecular Formula | C24H36N2O |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | 2,6-ditert-butyl-4-[[methyl(methylamino)amino]-(4-methylphenyl)methyl]phenol |
| SMILES | CNN(C)C(c1ccc(C)cc1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H36N2O/c1-16-10-12-17(13-11-16)21(26(9)25-8)18-14-19(23(2,3)4)22(27)20(15-18)24(5,6)7/h10-15,21,25,27H,1-9H3 |
| InChIKey | HZBPEJUKYSSFNT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|