C43H55N3O2 — CID 159020862
N'-(4-anilinophenyl)-N-(4-benzylphenyl)-N,N'-bis(4-methylpentan-2-yl)hexanediamide (PubChem CID 159020862) has the molecular formula C43H55N3O2 and a molecular weight of 645.93 g/mol. Its IUPAC name is N'-(4-anilinophenyl)-N-(4-benzylphenyl)-N,N'-bis(4-methylpentan-2-yl)hexanediamide.
| Compound Name | N'-(4-anilinophenyl)-N-(4-benzylphenyl)-N,N'-bis(4-methylpentan-2-yl)hexanediamide |
|---|---|
| PubChem CID | 159020862 |
| Molecular Formula | C43H55N3O2 |
| Molecular Weight | 645.93 g/mol |
| Exact Mass | 645.43 |
| IUPAC Name | N'-(4-anilinophenyl)-N-(4-benzylphenyl)-N,N'-bis(4-methylpentan-2-yl)hexanediamide |
| SMILES | CC(C)CC(C)N(C(=O)CCCCC(=O)N(c1ccc(Nc2ccccc2)cc1)C(C)CC(C)C)c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C43H55N3O2/c1-32(2)29-34(5)45(40-25-21-37(22-26-40)31-36-15-9-7-10-16-36)42(47)19-13-14-20-43(48)46(35(6)30-33(3)4)41-27-23-39(24-28-41)44-38-17-11-8-12-18-38/h7-12,15-18,21-28,32-35,44H,13-14,19-20,29-31H2,1-6H3 |
| InChIKey | JTRGICKDOHLPDY-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.93 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|