C19H26ClNO2 — CID 178069455
2-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxopentanenitrile (PubChem CID 178069455) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is 2-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxopentanenitrile.
| Compound Name | 2-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxopentanenitrile |
|---|---|
| PubChem CID | 178069455 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-chloro-4-(3,5-ditert-butyl-4-hydroxyphenyl)-3-oxopentanenitrile |
| SMILES | CC(C(=O)C(Cl)C#N)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H26ClNO2/c1-11(16(22)15(20)10-21)12-8-13(18(2,3)4)17(23)14(9-12)19(5,6)7/h8-9,11,15,23H,1-7H3 |
| InChIKey | HVIRMFSOGRYKRX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|