C19H20ClNO6S — CID 75445911
3-(5-chlorothiophen-2-yl)-3-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 75445911) has the molecular formula C19H20ClNO6S and a molecular weight of 425.89 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-3-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-(5-chlorothiophen-2-yl)-3-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 75445911 |
| Molecular Formula | C19H20ClNO6S |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-3-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | COc1cc(/C=C/C(=O)NC(CC(=O)O)c2ccc(Cl)s2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20ClNO6S/c1-25-13-8-11(9-14(26-2)19(13)27-3)4-7-17(22)21-12(10-18(23)24)15-5-6-16(20)28-15/h4-9,12H,10H2,1-3H3,(H,21,22)(H,23,24)/b7-4+ |
| InChIKey | IWIGCAYXZDCNIG-QPJJXVBHSA-N |
| XLogP | 3.77 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|