C23H26ClNO6 — CID 55877831
ethyl 3-[3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoylamino]-3-(3-methoxyphenyl)propanoate (PubChem CID 55877831) has the molecular formula C23H26ClNO6 and a molecular weight of 447.92 g/mol. Its IUPAC name is ethyl 3-[3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoylamino]-3-(3-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-[3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoylamino]-3-(3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 55877831 |
| Molecular Formula | C23H26ClNO6 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | ethyl 3-[3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoylamino]-3-(3-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)C=Cc1cc(Cl)c(OC)c(OC)c1)c1cccc(OC)c1 |
| InChI | InChI=1S/C23H26ClNO6/c1-5-31-22(27)14-19(16-7-6-8-17(13-16)28-2)25-21(26)10-9-15-11-18(24)23(30-4)20(12-15)29-3/h6-13,19H,5,14H2,1-4H3,(H,25,26) |
| InChIKey | IZXZLXYKIFWWLF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|