C21H24ClNO5 — CID 9477731
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]prop-2-enamide (PubChem CID 9477731) has the molecular formula C21H24ClNO5 and a molecular weight of 405.88 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9477731 |
| Molecular Formula | C21H24ClNO5 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(OC)c([C@@H](C)NC(=O)/C=C/c2cc(Cl)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H24ClNO5/c1-13(16-12-15(25-2)7-8-18(16)26-3)23-20(24)9-6-14-10-17(22)21(28-5)19(11-14)27-4/h6-13H,1-5H3,(H,23,24)/b9-6+/t13-/m1/s1 |
| InChIKey | FECOUMLIYWMSKP-YSKGHYERSA-N |
| XLogP | 4.26 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|