C21H24ClNO4 — CID 9263046
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]prop-2-enamide (PubChem CID 9263046) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9263046 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(C)cc1[C@@H](C)NC(=O)/C=C/c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H24ClNO4/c1-13-6-8-18(25-3)16(10-13)14(2)23-20(24)9-7-15-11-17(22)21(27-5)19(12-15)26-4/h6-12,14H,1-5H3,(H,23,24)/b9-7+/t14-/m1/s1 |
| InChIKey | JSAQELROAVTYCT-RCQQVGEISA-N |
| XLogP | 4.56 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|