C20H22ClNO5S — CID 46534284
methyl 3-[[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate (PubChem CID 46534284) has the molecular formula C20H22ClNO5S and a molecular weight of 423.92 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 46534284 |
| Molecular Formula | C20H22ClNO5S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | methyl 3-[[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)NC(CC(=O)OC)c2cccs2)cc1OC |
| InChI | InChI=1S/C20H22ClNO5S/c1-4-27-20-14(21)10-13(11-16(20)25-2)7-8-18(23)22-15(12-19(24)26-3)17-6-5-9-28-17/h5-11,15H,4,12H2,1-3H3,(H,22,23)/b8-7+ |
| InChIKey | MLWBPHMGEPHOTL-BQYQJAHWSA-N |
| XLogP | 4.24 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|