C24H23NO4S — CID 134033614
methyl 3-[[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate (PubChem CID 134033614) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 134033614 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | methyl 3-[[(E)-3-(3-phenylmethoxyphenyl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NC(=O)/C=C/c1cccc(OCc2ccccc2)c1)c1cccs1 |
| InChI | InChI=1S/C24H23NO4S/c1-28-24(27)16-21(22-11-6-14-30-22)25-23(26)13-12-18-9-5-10-20(15-18)29-17-19-7-3-2-4-8-19/h2-15,21H,16-17H2,1H3,(H,25,26)/b13-12+ |
| InChIKey | HEZQOWRRSPOSHA-OUKQBFOZSA-N |
| XLogP | 4.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|