C21H19NO3S2 — CID 134033604
methyl 3-[[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate (PubChem CID 134033604) has the molecular formula C21H19NO3S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 134033604 |
| Molecular Formula | C21H19NO3S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | methyl 3-[[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]amino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NC(=O)/C=C/c1ccc(-c2ccccc2)s1)c1cccs1 |
| InChI | InChI=1S/C21H19NO3S2/c1-25-21(24)14-17(19-8-5-13-26-19)22-20(23)12-10-16-9-11-18(27-16)15-6-3-2-4-7-15/h2-13,17H,14H2,1H3,(H,22,23)/b12-10+ |
| InChIKey | GYQGKYDFRHQUPQ-ZRDIBKRKSA-N |
| XLogP | 4.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|