C23H25NO3S — CID 121134172
N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-(4-propan-2-ylphenoxy)acetamide (PubChem CID 121134172) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-(4-propan-2-ylphenoxy)acetamide.
| Compound Name | N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-(4-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 121134172 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-[[5-[hydroxy(phenyl)methyl]thiophen-2-yl]methyl]-2-(4-propan-2-ylphenoxy)acetamide |
| SMILES | CC(C)c1ccc(OCC(=O)NCc2ccc(C(O)c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C23H25NO3S/c1-16(2)17-8-10-19(11-9-17)27-15-22(25)24-14-20-12-13-21(28-20)23(26)18-6-4-3-5-7-18/h3-13,16,23,26H,14-15H2,1-2H3,(H,24,25) |
| InChIKey | CZXKGDUSTOQKMI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |