C19H19NO4S — CID 121133399
N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]-2-(2-methylphenoxy)acetamide (PubChem CID 121133399) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]-2-(2-methylphenoxy)acetamide.
| Compound Name | N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]-2-(2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 121133399 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-[[5-[furan-2-yl(hydroxy)methyl]thiophen-2-yl]methyl]-2-(2-methylphenoxy)acetamide |
| SMILES | Cc1ccccc1OCC(=O)NCc1ccc(C(O)c2ccco2)s1 |
| InChI | InChI=1S/C19H19NO4S/c1-13-5-2-3-6-15(13)24-12-18(21)20-11-14-8-9-17(25-14)19(22)16-7-4-10-23-16/h2-10,19,22H,11-12H2,1H3,(H,20,21) |
| InChIKey | LFOWLWNXJFQLCY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |