C23H26N2O4 — CID 55797930
3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[[3-(propan-2-yloxymethyl)phenyl]methyl]propanamide (PubChem CID 55797930) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[[3-(propan-2-yloxymethyl)phenyl]methyl]propanamide.
| Compound Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[[3-(propan-2-yloxymethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 55797930 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[[3-(propan-2-yloxymethyl)phenyl]methyl]propanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)NCc1cccc(COC(C)C)c1)C2=O |
| InChI | InChI=1S/C23H26N2O4/c1-15(2)29-14-18-6-4-5-17(12-18)13-24-21(26)9-10-25-22(27)19-8-7-16(3)11-20(19)23(25)28/h4-8,11-12,15H,9-10,13-14H2,1-3H3,(H,24,26) |
| InChIKey | WSXFWWLHMURKDO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|