C19H16F2N2O4 — CID 47087962
N-[[3-(difluoromethoxy)phenyl]methyl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 47087962) has the molecular formula C19H16F2N2O4 and a molecular weight of 374.34 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)phenyl]methyl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[[3-(difluoromethoxy)phenyl]methyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 47087962 |
| Molecular Formula | C19H16F2N2O4 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[[3-(difluoromethoxy)phenyl]methyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)NCc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C19H16F2N2O4/c20-19(21)27-13-5-3-4-12(10-13)11-22-16(24)8-9-23-17(25)14-6-1-2-7-15(14)18(23)26/h1-7,10,19H,8-9,11H2,(H,22,24) |
| InChIKey | OVXAIRJMWQZTMM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|