C23H19F3N4O3 — CID 55610959
4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]butanamide (PubChem CID 55610959) has the molecular formula C23H19F3N4O3 and a molecular weight of 456.42 g/mol. Its IUPAC name is 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 55610959 |
| Molecular Formula | C23H19F3N4O3 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[4-pyrazol-1-yl-2-(trifluoromethyl)phenyl]butanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)Nc1ccc(-n3cccn3)cc1C(F)(F)F)C2=O |
| InChI | InChI=1S/C23H19F3N4O3/c1-14-5-7-16-17(12-14)22(33)29(21(16)32)10-2-4-20(31)28-19-8-6-15(30-11-3-9-27-30)13-18(19)23(24,25)26/h3,5-9,11-13H,2,4,10H2,1H3,(H,28,31) |
| InChIKey | YXUSNRDJJKKVHV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|